![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 0_vidConv - common data, operators.ndf | 2021-12-01 10:06 | 10K | |
| 0_vidConv DrumLib.ndf | 2021-12-01 10:07 | 6.6K | |
| 0_vidProdn - common data, operators.ndf | 2021-12-01 10:08 | 40K | |
| 0_vidProdnDrumLib.ndf | 2021-12-01 10:08 | 33K | |
![[ ]](/icons/odf6ods-20x22.png) | 0_vidProdn DrumLib.ods | 2017-10-25 21:22 | 72K | |
| 0_vidProdn header- common data.ndf | 2021-12-01 10:10 | 6.9K | |
| 0_video capture - dimensions.ods | 2023-05-29 10:09 | 26K | |
![[TXT]](/icons/text.gif) | 1_Howell - video capture instructions (old).txt | 2025-05-24 23:44 | 12K | |
| 5_video production QNial.link.txt | 2025-04-29 21:05 | 187 | |
| Structure.ndf | 2017-10-15 18:12 | 11K | |
![[DIR]](/icons/folder.gif) | app_inits/ | 2025-05-02 21:33 | - | |
| audioBalance DrumLib.sh | 2021-12-01 10:06 | 2.7K | |
| audio capture.sh | 2024-01-06 13:07 | 6.2K | |
| audio catenate.sh | 2022-04-03 19:24 | 1.8K | |
| audio convert.sh | 2022-04-01 23:41 | 1.6K | |
| audio play.sh | 2022-11-15 18:14 | 271 | |
| capture video and audio, recordMyDesktop.sh | 2024-07-06 13:42 | 11K | |
| capture video header.sh | 2021-12-01 10:02 | 17K | |
| catenate DrumLib videos.sh | 2023-10-26 21:26 | 2.4K | |
| convert MTS to ogv.ods | 2017-10-25 14:44 | 27K | |
| convert MTS to ogv.sh | 2025-05-25 08:34 | 6.1K | |
| pSortedL_rename_as_intL.sh.link.txt | 2024-08-04 19:47 | 147 | |
| video-audio combine [mp4, mp3].sh | 2025-05-24 23:19 | 1.9K | |
| video convert [ogv,avi, mp4, MTS, etc].sh | 2021-12-01 09:55 | 2.9K | |
| video convert notes.txt | 2021-12-01 11:53 | 21K | |
| video cut.sh | 2025-05-24 23:46 | 3.5K | |
| video cut header.sh | 2023-11-07 12:56 | 5.1K | |
| videos IJCNN2021 watch.sh | 2021-12-01 09:55 | 12K | |
| video text scroll.sh | 2021-12-01 09:56 | 680 | |
| windows - position, size, move, desktop opens.ndf | 2017-10-18 09:17 | 22K | |
|
|---|