![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | 0_list of Howells QNial [ndf, optr]s.txt | 2022-07-09 17:58 | 92K | |
| 4_txtLin markers notes.link.txt | 2024-09-12 10:47 | 41 | |
![[DIR]](/icons/folder.gif) | Bessel/ | 2023-11-13 18:13 | - | |
| Bessell - Runge-Kutta/ | 2023-11-13 18:13 | - | |
![[ ]](/icons/unknown.gif) | Capitalize first letters.ndf | 2021-02-07 06:30 | 2.2K | |
| Carve up textFile.ndf | 2021-02-07 06:34 | 2.0K | |
| Cash-Karp-Runge-Kutta integrate ODEs with accuracy monitoring.ndf | 2021-02-08 12:44 | 10K | |
| Cheng - semi-tensor and switching control, Matlab toolbox/ | 2023-11-13 18:13 | - | |
| Climate and Sun/ | 2023-11-13 19:12 | - | |
| Colin James, Kanban cell NN model, Howell 160316 .ndf | 2016-03-16 15:33 | 12K | |
| Colin James 4-value logic Kanban cell NN model 160316.ndf | 2021-10-30 07:24 | 13K | |
| Examples/ | 2023-11-13 19:12 | - | |
| Greek & Latin symbols test.ndf | 2017-04-09 19:18 | 183 | |
| IJCNN 2013 Dallas TX/ | 2023-11-13 19:12 | - | |
| Interpolation.ndf | 2021-01-04 12:25 | 18K | |
| Interpolation linear data table.ndf | 2020-12-29 17:32 | 3.2K | |
| JulianDay_to_GregorianDate.ndf | 2019-05-04 11:28 | 5.3K | |
| Kp geomag index - translate data files [NOAA, Potsdam].ndf | 2020-05-31 16:08 | 20K | |
| Kronecker_prod.ndf | 2019-05-04 11:28 | 1.5K | |
| LeastCommonMultiple.ndf | 2019-05-04 11:28 | 625 | |
| Linux signals - see also 0_vidProdn - common data, operators.ndf.txt | 2021-04-25 11:09 | 125 | |
| Linux signals applications non-window.ndf | 2021-04-26 16:30 | 3.1K | |
| MindCode/ | 2026-01-16 09:24 | - | |
| Music - radio record, cut, splice.ndf | 2021-02-08 12:02 | 2.7K | |
| NEUNET-D-14-00130 tests.ndf | 2021-02-08 12:05 | 2.2K | |
| ODE Cash-Karp-Runge-Kutta integrate ODEs with accuracy monitoring.ndf | 2021-02-08 13:25 | 11K | |
| ODE runge-kutta 4, C code.txt | 2021-02-08 13:33 | 1.5K | |
| Ord Diff Eq Integration/ | 2023-11-13 19:13 | - | |
| PRINT.NDF | 2021-02-08 19:39 | 2.1K | |
| PROFILE.NDF | 2021-02-09 07:46 | 13K | |
| PayPal transaction text process.ndf | 2021-02-08 13:55 | 3.2K | |
| QNial [op, test, startup]s.link.txt | 2024-03-15 10:30 | 857 | |
| QNial [symbol, arg] changes/ | 2025-05-02 20:51 | - | |
| QNial setup - QNial envVarL.txt | 2026-01-06 15:05 | 1.9K | |
| QNial setup - bash envVarL.txt | 2026-01-06 11:41 | 1.4K | |
| QNial setup - header.ndf | 2026-01-06 13:33 | 8.2K | |
| QNial setup.ndf | 2024-04-18 17:19 | 12K | |
| SP500 Shiller-forward PE ratio and Tbond rates.ndf | 2021-02-09 09:55 | 1.8K | |
| SP500 semi-log linear fit 2 points, other oddball calcs.ndf | 2022-01-07 22:35 | 5.0K | |
| Scratchpad.txt | 2021-09-11 20:34 | 456 | |
| Smillie UAlberta - statistics 1987/ | 2023-11-13 19:15 | - | |
| Solar insolation make.ndf.lnk | 2017-04-09 19:18 | 1.0K | |
| Structure.ndf | 2021-02-04 10:41 | 24K | |
| Toshiba start_Computer winList.txt | 2017-04-09 19:18 | 900 | |
| Toshiba winlist 160410 | 2017-04-09 19:18 | 682 | |
| USB_backup/ | 2023-11-13 19:16 | - | |
| USB workspace loads - winList.txt | 2017-08-15 13:42 | 1.5K | |
| USB workspace loads.ndf | 2021-02-09 12:14 | 19K | |
| [video, audio] files [crop, convert, blend, synchronize].ndf | 2020-12-22 18:38 | 5.2K | |
| apps - headings,refs,images,audio,video.ndf | 2019-05-04 11:28 | 526 | |
| arrays [ToDos, warnings].txt | 2022-10-08 20:05 | 2.5K | |
| arrays atomic- develop.link.txt | 2024-03-22 10:37 | 203 | |
| arrays atomic.ndf | 2024-04-06 18:10 | 109K | |
| arrays atomic TblOfContents.txt | 2024-03-28 18:57 | 20K | |
| arrays nested- develop.link.txt | 2024-03-22 11:42 | 205 | |
| arrays nested.ndf | 2024-04-20 19:52 | 13K | |
| arrays nested TblOfContents.txt | 2024-04-01 11:05 | 2.1K | |
| arrays nested zByVal.ndf | 2024-04-07 10:09 | 11K | |
| arrays nested zByVal TblOfContents.txt | 2024-04-01 18:57 | 1.5K | |
| audio - music, microphone.ndf | 2021-02-07 05:51 | 9.2K | |
| audio file concatenation - sox.ndf | 2021-02-07 05:50 | 2.4K | |
| audio notes.txt | 2021-09-11 20:34 | 2.9K | |
| bank statements - PayPal transaction text process.ndf | 2021-06-11 11:34 | 3.3K | |
| bank statements instructions.txt | 2023-03-02 15:07 | 4.5K | |
| bank statements reformat.ndf | 2023-07-20 09:23 | 8.6K | |
| base64_pre_clean for mime.ndf | 2021-02-08 11:31 | 3.1K | |
| base64_test_host.ndf | 2021-02-07 06:02 | 928 | |
| boolean.ndf | 2024-04-06 17:51 | 24K | |
| callerID-SNNs/ | 2024-01-21 23:17 | - | |
| conference guides - header.ndf | 2021-02-07 06:46 | 9.1K | |
| conference guides - update inserts.ndf | 2021-09-29 15:18 | 11K | |
| conversion_of_units gnu.txt | 2025-04-20 15:56 | 59 | |
| conversions meter-to-feet etc.ndf | 2025-04-20 15:56 | 2.2K | |
| copyover - remove empty directories.ndf | 2021-02-07 07:06 | 2.1K | |
| copyover inn.txt | 2017-04-09 19:18 | 25K | |
| copyover out.txt | 2017-04-09 19:18 | 212 | |
| cron QNial scheduling.ndf | 2021-05-18 17:18 | 4.0K | |
| dictionaries - how NOT to process.ndf | 2021-07-01 15:25 | 7.7K | |
| dictionaries.ndf | 2021-07-01 21:58 | 25K | |
| dictionaries/ | 2023-11-13 19:18 | - | |
| dictionary notes.txt | 2021-07-02 08:47 | 52K | |
| diff - see also txtFile compare.ndf.txt | 2021-09-11 20:34 | 81 | |
| diff_Howell.ndf | 2022-07-23 12:03 | 3.2K | |
| diff unicode.ndf | 2021-02-07 07:11 | 2.3K | |
| directed graphs.ndf | 2021-02-07 07:22 | 13K | |
| dropped text.txt | 2019-02-07 12:37 | 44 | |
| economics, markets/ | 2025-05-02 20:51 | - | |
| email - mass response processing/ | 2022-07-06 04:37 | - | |
| email/ | 2026-01-16 09:24 | - | |
| email fix Thunderbird/ | 2025-05-02 20:52 | - | |
| email ndfs link.txt | 2023-03-13 11:27 | 27 | |
| encryption.ndf | 2024-11-24 10:37 | 5.1K | |
| fault QNial Howell sorted.txt | 2022-05-06 14:26 | 3.8K | |
| faults (copy).ndf | 2022-06-22 14:27 | 5.8K | |
| faults - header.ndf | 2022-07-08 06:59 | 1.2K | |
| faults.ndf | 2024-03-26 09:44 | 6.5K | |
| file_ops.ndf | 2026-01-06 14:28 | 108K | |
| file_ops.ndf TblOfCont.txt | 2026-01-06 11:59 | 13K | |
| file_ops.ndf notes.txt | 2026-01-06 14:45 | 1.4K | |
| fit Cl2_$.NDF | 2021-03-26 14:39 | 4.0K | |
| fit Cl2_$ regression.txt | 2021-03-26 14:38 | 8.0K | |
| fit_linearRegress, KW Smillie.NDF | 2021-03-26 14:38 | 5.9K | |
| fit_linearRegress - notes.txt | 2022-07-19 18:33 | 7.7K | |
| fit_linearRegress.ndf | 2023-04-17 14:19 | 31K | |
| fit_linearRegress log.txt | 2022-08-14 11:41 | 4.7K | |
| forecast.ndf | 2021-03-26 14:38 | 12K | |
| forecast example.txt | 2021-03-26 14:39 | 124K | |
| genetic algorithm.ndf | 2021-03-26 14:39 | 14K | |
| genetics example1 results.nlg | 2021-03-26 14:38 | 14K | |
| genetics example1 results with gene_decay 0.95.nlg | 2021-03-26 14:39 | 14K | |
| gnuplot direct - template.plt | 2022-08-16 08:35 | 2.5K | |
| gnuplot header.ndf | 2022-08-26 16:54 | 6.0K | |
| gnuplot via auto-fill - template.plt | 2022-08-15 20:00 | 2.7K | |
| gnuplot via auto-fill.ndf | 2022-09-11 15:00 | 5.2K | |
| gnuplot via subFiles - template.plt | 2022-08-17 12:04 | 2.5K | |
| gnuplot via subFiles.ndf | 2022-09-09 10:57 | 20K | |
| gradient2.nlg | 2021-03-26 14:38 | 60K | |
| gradient_test.nlg | 2021-03-26 14:39 | 114K | |
| iconv - Unicode to ASCII/ | 2023-09-18 16:44 | - | |
| imagemagic howell-image-translate-rotate - tests of combined.txt | 2021-03-26 14:38 | 2.5K | |
| imagemagic howell-image-translate-rotate.ndf | 2021-03-26 14:39 | 19K | |
| interpolate - linear, data table.ndf | 2021-03-26 14:38 | 2.5K | |
| list [sort,cull] ops.ndf | 2024-11-24 10:01 | 2.5K | |
| list searches - [sequential, bisections].ndf | 2021-03-26 14:38 | 3.4K | |
| make - advice.txt | 2021-03-26 14:39 | 3.8K | |
| make - example.ndf | 2021-03-26 14:39 | 13K | |
| math - Runge-Kutta and Bessel.ndf | 2021-03-26 14:39 | 14K | |
| math - [quick, handy] stuff.ndf | 2024-03-26 09:56 | 16K | |
| math - [quick, handy] stuff notes.ndf | 2023-04-17 08:56 | 3.1K | |
| math - trigonometry.ndf | 2021-03-26 14:39 | 3.8K | |
| matrix - symbolic, parenthesis aligned.ndf | 2021-03-26 14:39 | 13K | |
| matrix - symbolic reduction.ndf | 2021-03-26 14:38 | 21K | |
| matrix - write with parenthesis aligned.ndf | 2021-03-26 14:39 | 19K | |
| matrix derivatives in [cartesian, cylindrical, spherical] coordinates.ndf | 2021-03-26 14:39 | 11K | |
| matrix operations - symbolic & real-valued.ndf | 2022-04-15 12:34 | 63K | |
| numberBase conversions.ndf | 2021-03-26 14:39 | 15K | |
| optimize - particle swarm.ndf | 2021-06-06 09:36 | 10K | |
| paper reviews - raw review.out | 2021-03-26 14:39 | 7.4K | |
| paper reviews - strip out illegal characters.ndf | 2021-03-26 14:38 | 4.7K | |
| photo albums - extract descriptions.ndf | 2021-09-19 15:11 | 4.3K | |
| port C to Nial.NDF | 2021-03-26 14:38 | 8.4K | |
| port GREP_Fortran_to_QNial.ndf | 2021-03-26 14:39 | 5.0K | |
| port Matlab to Nial.ndf | 2021-09-29 15:32 | 8.0K | |
| port SciLab to Nial.NDF | 2021-03-26 14:39 | 7.6K | |
| port_translate_Fortran_to_QNial.ndf | 2021-03-26 14:38 | 5.7K | |
| port_translate_Matlab_to_QNial.ndf | 2021-09-29 15:29 | 16K | |
| port fortran to Nial.NDF | 2021-03-26 14:38 | 8.8K | |
| random_lists.ndf | 2024-11-24 09:55 | 725 | |
| readDataFile.ndf | 2021-03-26 14:38 | 5.3K | |
| readDataFile corona virus global.ndf | 2021-03-26 14:39 | 6.4K | |
| readDataFile fixed cols suicides USA - old version.ndf | 2021-03-26 14:39 | 10K | |
| readDataFile header.ndf | 2021-03-26 14:38 | 10K | |
| readDataFile suicides USA.ndf | 2021-03-26 14:39 | 15K | |
| readDataFile suicides USA header.ndf | 2021-03-26 14:38 | 6.5K | |
| readFile_Unix.ndf | 2021-03-26 14:39 | 1.4K | |
| review_setup.sh.link | 2021-03-26 14:39 | 64 | |
| review move comments and strip illegal characters.ndf | 2021-06-06 09:30 | 12K | |
| reviews - form copy.sh.link | 2021-03-26 14:39 | 77 | |
| reviews Schmidhuber - references analysis.ndf | 2021-02-09 09:02 | 13K | |
| reviews of math - listing & results.ndf | 2021-03-26 14:39 | 4.8K | |
| semi-log formula.ndf | 2021-03-26 14:39 | 4.0K | |
| semi-tensor product - examples and checks.ndf | 2021-03-26 14:38 | 11K | |
| semi-tensor product.ndf | 2021-03-26 14:39 | 12K | |
| spreadsheet - text.in | 2021-03-26 14:38 | 5.7K | |
| spreadsheet - text.out | 2021-03-26 14:38 | 12 | |
| spreadsheet from text preps.ndf | 2021-03-26 14:38 | 4.7K | |
| strings- unicode chars by decInt combinations.txt | 2021-03-26 14:39 | 51K | |
| strings.ndf | 2026-01-06 11:59 | 78K | |
| strings.ndf TblOfCont.txt | 2026-01-06 11:58 | 13K | |
| strings TblOfContents (copy).txt | 2022-09-27 10:51 | 13K | |
| strings header.ndf | 2025-05-15 10:10 | 9.0K | |
| symbolic reduction.ndf | 2022-02-12 10:08 | 41K | |
| symsFlatLiner/ | 2025-05-02 20:52 | - | |
| translate - see port and symbols.txt | 2021-03-26 14:38 | 78 | |
| txtFile - replace coded segments.ndf | 2022-07-23 11:59 | 3.8K | |
| txtFile compare.ndf | 2021-03-26 14:38 | 8.0K | |
| type_check.ndf | 2022-04-08 08:41 | 1.7K | |
| types [atomic, nested].link.txt | 2024-03-23 09:05 | 484 | |
| types atomic.ndf | 2024-04-12 11:07 | 47K | |
| types atomic TblOfContents.txt | 2024-04-04 17:13 | 6.2K | |
| types nested.ndf | 2024-04-18 15:03 | 21K | |
| types nested TblOfContents.txt | 2024-04-10 11:20 | 3.7K | |
| uni2ascii/ | 2023-09-18 16:44 | - | |
| video production/ | 2021-03-26 15:50 | - | |
| virus - clamscan output filtering of viruses found.ndf | 2021-03-26 14:38 | 3.8K | |
| virus - remove emails with virus.ndf | 2021-03-29 18:52 | 2.4K | |
| vlc_kill.ndf | 2021-03-26 14:38 | 777 | |
| vlc_kill.txt | 2021-03-26 14:38 | 35 | |
| window menus - alternative, old setup.ndf | 2021-06-11 11:31 | 13K | |
| windows - header.ndf | 2022-07-08 06:59 | 6.9K | |
| windows - see also 0_vidProdn - common data, operators.ndf.txt | 2021-04-25 11:11 | 119 | |
| windows.ndf | 2023-04-10 15:59 | 16K | |
| windows system for startup.ndf | 2021-03-26 14:39 | 8.5K | |
| workFlow loop.ndf | 2021-06-06 09:35 | 6.0K | |
| writeBreak.ndf | 2024-04-18 17:17 | 1.8K | |
| z_historic/ | 2026-01-15 20:21 | - | |
|
|---|