![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | IEEE-CIS/ | 2018-01-12 10:19 | - | |
![[ ]](/icons/odf6odt-20x22.png) | Howell 150225 - MindCode Manifesto.odt | 2018-05-27 06:59 | 94K | |
![[ ]](/icons/layout.gif) | Howell 110824 - Confabulation Theory - Plausible next sentence survey.pdf | 2020-04-14 11:50 | 1.2M | |
![[ ]](/icons/layout.gif) | Howell 110903 - Confabulation Theory, Plausible next sentence survey.pdf | 2020-04-14 11:51 | 1.6M | |
![[ ]](/icons/layout.gif) | Howell 131013 Robots, Signal Processing and Control Theory - Random, stray thoughts.pdf | 2020-04-14 11:51 | 225K | |
![[ ]](/icons/layout.gif) | Howell 2006 - Genetic specification of neural networks, draft concepts and implications.pdf | 2020-04-14 11:51 | 211K | |
![[IMG]](/icons/image2.gif) | Siegelmann, Hava.jpg | 2020-04-14 11:51 | 46K | |
![[ ]](/icons/layout.gif) | Howell 131011 fMRI - Random, stray thoughts.pdf | 2020-04-14 11:51 | 192K | |
![[ ]](/icons/unknown.gif) | Howell 2005 - Presentation, Junk DNA and Neural Networks conjecture on directions and implications.ppt | 2020-04-14 11:52 | 1.2M | |
![[IMG]](/icons/image2.gif) | phto - Pablo Estevez.png | 2020-04-14 11:52 | 47K | |
![[ ]](/icons/unknown.gif) | Howell 2006 - Presentation, Genetic Specification of Recurrent Neural Networks Initial Thoughts.ppt | 2020-04-14 11:52 | 6.0M | |
![[ ]](/icons/unknown.gif) | Confabulation Theory - Plausible next sentence survey 110902 Howell standalone.doc | 2020-09-23 14:59 | 2.1M | |
![[TXT]](/icons/text.gif) | Howell 201110 - Financial markets and Computational Intelligence, questions.txt | 2020-11-22 18:40 | 9.5K | |
![[ ]](/icons/odf6odt-20x22.png) | 5_NN - interesting throughts and items.odt | 2021-03-26 14:30 | 45K | |
![[TXT]](/icons/text.gif) | 5_Neural Nets keep in mind.txt | 2022-07-05 17:44 | 24K | |
![[DIR]](/icons/folder.gif) | DevelopingMinds/ | 2023-01-20 10:02 | - | |
![[DIR]](/icons/folder.gif) | INNS/ | 2023-01-20 10:02 | - | |
![[DIR]](/icons/folder.gif) | gpt-3/ | 2023-01-20 10:02 | - | |
![[ ]](/icons/layout.gif) | Sejnowski 21Aug2022 Large Language Models and the Reverse Turing Test.pdf | 2023-03-31 19:55 | 1.0M | |
![[DIR]](/icons/folder.gif) | Conference guides/ | 2023-11-13 18:00 | - | |
![[TXT]](/icons/text.gif) | MindCode project collection.html.link.txt | 2024-03-05 10:57 | 50 | |
![[ ]](/icons/layout.gif) | Baldi 03Jun2024 AI international effort + largest [data, computing] center on Earth + CERN-like structure.pdf | 2024-06-22 22:46 | 48K | |
![[TXT]](/icons/text.gif) | 0_Neural Nets notes public TableOfContents.txt | 2024-08-24 08:38 | 7.5K | |
![[TXT]](/icons/text.gif) | 240824 emto Perry Kinkaide: ChatGPT explains Stephen Grossberg.html.link.txt | 2024-08-24 10:18 | 131 | |
![[DIR]](/icons/folder.gif) | Paper reviews/ | 2025-05-02 18:42 | - | |
![[DIR]](/icons/folder.gif) | cool stuff/ | 2025-05-02 18:43 | - | |
![[DIR]](/icons/folder.gif) | robots/ | 2025-05-02 18:43 | - | |
![[DIR]](/icons/folder.gif) | z_history/ | 2025-05-02 18:43 | - | |
![[TXT]](/icons/text.gif) | Schmidhuber papers, Howell [review, question]s.doc.link.txt | 2025-05-20 10:31 | 511 | |
![[TXT]](/icons/text.gif) | 0_Neural Nets notes public.txt | 2025-08-03 19:51 | 161K | |
![[DIR]](/icons/folder.gif) | LLMs/ | 2026-01-15 16:37 | - | |
![[DIR]](/icons/folder.gif) | Musk NeuraLink/ | 2026-01-15 16:37 | - | |
![[DIR]](/icons/folder.gif) | References/ | 2026-01-15 19:33 | - | |
![[DIR]](/icons/folder.gif) | Schmidhuber/ | 2026-01-15 19:33 | - | |
![[DIR]](/icons/folder.gif) | callerID-SNNs/ | 2026-01-16 09:19 | - | |
![[TXT]](/icons/text.gif) | Computational neuro-genetic modelling.HtmWeb.html | 2026-01-16 09:19 | 6.8K | |
![[DIR]](/icons/folder.gif) | consciousness/ | 2026-01-16 09:19 | - | |
![[DIR]](/icons/folder.gif) | dendrite/ | 2026-01-16 09:19 | - | |
![[DIR]](/icons/folder.gif) | emotion/ | 2026-01-16 09:19 | - | |
![[DIR]](/icons/folder.gif) | genetic mechanisms/ | 2026-01-16 09:19 | - | |
![[DIR]](/icons/folder.gif) | Grossberg/ | 2026-01-16 09:20 | - | |
![[TXT]](/icons/text.gif) | Holidays - neural networks and genomics.HtmWeb.html | 2026-01-16 09:20 | 18K | |
![[TXT]](/icons/text.gif) | Howell [callerID-SNNs, [DNA, RNA] program code, MindCode, Grossberg].HtmNwp.html | 2026-01-16 09:20 | 13K | |
![[DIR]](/icons/folder.gif) | MindCode/ | 2026-01-16 09:20 | - | |
![[TXT]](/icons/text.gif) | MindCode project collection.HtmWeb.html | 2026-01-16 09:20 | 3.6K | |
![[TXT]](/icons/text.gif) | Neural Networks.HtmWeb.html | 2026-01-16 09:20 | 4.5K | |
![[TXT]](/icons/text.gif) | Pribram 1993 Rethinking neural networks, Quantum fields and biological data, TableOfContents.HtmWeb.html | 2026-01-16 09:20 | 4.2K | |
![[DIR]](/icons/folder.gif) | Transformer NNs/ | 2026-01-16 09:20 | - | |
|