![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/odf6ods-20x22.png){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0_audioBalance DrumLib.sh | 2017-10-29 14:53 | 2.8K | |
| 0_vidConv - common data, operators.ndf | 2017-10-29 14:53 | 10K | |
| 0_vidConv DrumLib.ndf | 2017-10-29 14:53 | 6.6K | |
| 0_vidProdn - common data, operators.ndf | 2017-10-29 14:53 | 40K | |
| 0_vidProdnDrumLib.ndf | 2017-10-29 14:53 | 33K | |
| 0_vidProdn DrumLib.ods | 2017-10-29 14:53 | 72K | |
| 0_vidProdn header- common data.ndf | 2017-10-29 14:53 | 6.9K | |
| 0_video capture - dimensions.ods | 2017-10-29 14:53 | 20K | |
| Structure.ndf | 2017-10-29 14:54 | 11K | |
| app_inits/ | 2017-10-28 13:15 | - | |
| audio-video merge.sh | 2017-10-29 14:54 | 1.6K | |
| capture audio - DrumLib.sh | 2017-10-29 14:54 | 4.1K | |
| capture scene - DrumLib.sh | 2017-10-29 14:54 | 2.9K | |
| capture video - DrumLib.sh | 2017-10-29 14:54 | 6.6K | |
| catenate DrumLib videos.sh | 2017-10-29 14:54 | 917 | |
| convert MTS to ogv.ods | 2017-10-29 14:54 | 27K | |
| convert MTS to ogv.sh | 2017-10-29 14:54 | 5.9K | |
| strings.ndf | 2017-10-29 14:54 | 27K | |
| windows - position, size, move, desktop opens.ndf | 2017-10-29 14:54 | 24K | |